EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N4O3 |
| Net Charge | 0 |
| Average Mass | 176.176 |
| Monoisotopic Mass | 176.09094 |
| SMILES | NC(N)=NOCCC(N)C(=O)O |
| InChI | InChI=1S/C5H12N4O3/c6-3(4(10)11)1-2-12-9-5(7)8/h3H,1-2,6H2,(H,10,11)(H4,7,8,9) |
| InChIKey | FSBIGDSBMBYOPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DL-Canavanine (CHEBI:180947) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-4-(diaminomethylideneamino)oxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 269 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13269-28-8 | ChemIDplus |