EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26D6O3 |
| Net Charge | 0 |
| Average Mass | 326.510 |
| Monoisotopic Mass | 326.27281 |
| SMILES | [2H]C([2H])(/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O)C([2H])([2H])C([2H])([2H])CCO |
| InChI | InChI=1S/C20H32O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h1,3-4,6-7,9-10,12,21H,2,5,8,11,13-19H2,(H,22,23)/b3-1-,6-4-,9-7-,12-10-/i11D2,13D2,15D2 |
| InChIKey | NNDIXBJHNLFJJP-KVJJYFOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS1183) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-HETE-d6 (CHEBI:180941) is a deuterated fatty acid (CHEBI:75427) |
| 20-HETE-d6 (CHEBI:180941) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z)-16,16,17,17,18,18-hexadeuterio-20-hydroxyicosa-5,8,11,14-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03060082 | LIPID MAPS |
| 17220806 | ChemSpider |