EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15N2O5P |
| Net Charge | 0 |
| Average Mass | 250.191 |
| Monoisotopic Mass | 250.07186 |
| SMILES | O=C(O)[C@H]1CN(C/C=C/P(=O)(O)O)CCN1 |
| InChI | InChI=1S/C8H15N2O5P/c11-8(12)7-6-10(4-2-9-7)3-1-5-16(13,14)15/h1,5,7,9H,2-4,6H2,(H,11,12)(H2,13,14,15)/b5-1+/t7-/m1/s1 |
| InChIKey | VZXMZMJSGLFKQI-ABVWVHJUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| midafotel (CHEBI:180900) has role anticonvulsant (CHEBI:35623) |
| midafotel (CHEBI:180900) has role neuroprotective agent (CHEBI:63726) |
| midafotel (CHEBI:180900) has role NMDA receptor antagonist (CHEBI:60643) |
| midafotel (CHEBI:180900) is a monocarboxylic acid (CHEBI:25384) |
| midafotel (CHEBI:180900) is a olefinic compound (CHEBI:78840) |
| midafotel (CHEBI:180900) is a phosphonic acids (CHEBI:26069) |
| midafotel (CHEBI:180900) is a piperazinecarboxylic acid (CHEBI:48683) |
| midafotel (CHEBI:180900) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2R)-4-[(2E)-3-phosphonoprop-2-en-1-yl]piperazine-2-carboxylic acid |
| INNs | Source |
|---|---|
| midafotel | WHO MedNet |
| midafotelum | WHO MedNet |
| midafotel | WHO MedNet |
| midafotel | WHO MedNet |
| Synonyms | Source |
|---|---|
| D-CPPene | SUBMITTER |
| SDZ-EAA-494 | SUBMITTER |
| D-CPP-ene | ChemIDplus |
| SDZ-EAA 494 | ChemIDplus |
| SDZ EAA 494 | ChEBI |
| (2R)-4-[(2E)-3-phosphono-2-propenyl]-2-piperazinecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:117414-74-1 | ChemIDplus |
| Citations |
|---|