EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H62N7O17P3S |
| Net Charge | 0 |
| Average Mass | 977.902 |
| Monoisotopic Mass | 977.31357 |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@H](C)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C35H62N7O17P3S/c1-21(2)9-7-10-22(3)11-8-12-23(4)34(47)63-16-15-37-25(43)13-14-38-32(46)29(45)35(5,6)18-56-62(53,54)59-61(51,52)55-17-24-28(58-60(48,49)50)27(44)33(57-24)42-20-41-26-30(36)39-19-40-31(26)42/h19-24,27-29,33,44-45H,7-18H2,1-6H3,(H,37,43)(H,38,46)(H,51,52)(H,53,54)(H2,36,39,40)(H2,48,49,50)/t22-,23+,24-,27-,28-,29+,33-/m1/s1 |
| InChIKey | QCNISQOYPUIJJO-KIWPZKLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2150) |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,6R,10)-trimethyl-hendecanoyl-CoA (CHEBI:180894) is a fatty acyl-CoA (CHEBI:37554) |
| Synonyms | Source |
|---|---|
| (2S,6R,10R)-trimethyl-hendecanoyl-CoA | FooDB |
| (2S,6R,10R)-trimethyl-hendecanoyl-coenzyme A | ChEBI |
| (2S,6R,10)-trimethyl-hendecanoyl-coenzyme A | ChEBI |
| (2S,6R)-2,6,10-trimethyl-hendecanoyl-coA | ChEBI |
| (2S,6R)-2,6,10-trimethyl-hendecanoyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB029081 | FooDB |
| HMDB0012471 | HMDB |