EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28O9 |
| Net Charge | 0 |
| Average Mass | 508.523 |
| Monoisotopic Mass | 508.17333 |
| SMILES | CC12C(=O)C=CC=C1C=CC1C2CCC2(O)C(=O)OC3(C)C4CC5(C)C(COC16C(=O)OC23C56)C(=O)O4 |
| InChI | InChI=1S/C28H28O9/c1-23-11-18-25(3)28-20(23)27(22(32)37-28,34-12-16(23)19(30)35-18)15-8-7-13-5-4-6-17(29)24(13,2)14(15)9-10-26(28,33)21(31)36-25/h4-8,14-16,18,20,33H,9-12H2,1-3H3 |
| InChIKey | KUSIVZBQAMNZCO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,7-Didehydroneophysalin B (CHEBI:180854) is a physalin (CHEBI:76361) |
| IUPAC Name |
|---|
| 5-hydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.2.01,5.02,24.08,17.09,14.018,27.021,26]nonacosa-11,13,15-triene-4,10,22,29-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 35014860 | ChemSpider |
| HMDB0039695 | HMDB |