EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O5 |
| Net Charge | 0 |
| Average Mass | 398.499 |
| Monoisotopic Mass | 398.20932 |
| SMILES | CC(C)=C[C@@H]1C[C@H](C)[C@@H](COc2ccc3ccc(=O)oc3c2)[C@]1(C)CCC(=O)O |
| InChI | InChI=1S/C24H30O5/c1-15(2)11-18-12-16(3)20(24(18,4)10-9-22(25)26)14-28-19-7-5-17-6-8-23(27)29-21(17)13-19/h5-8,11,13,16,18,20H,9-10,12,14H2,1-4H3,(H,25,26)/t16-,18+,20+,24+/m0/s1 |
| InChIKey | OFSGQKZUVVKFEX-XXDRUXBBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ferula sinaica (ncbitaxon:1514050) | Root (BTO:0001188) | PubMed (17258243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferulsinaic acid (CHEBI:180832) has role geroprotector (CHEBI:176497) |
| ferulsinaic acid (CHEBI:180832) has role plant metabolite (CHEBI:76924) |
| ferulsinaic acid (CHEBI:180832) is a aromatic ether (CHEBI:35618) |
| ferulsinaic acid (CHEBI:180832) is a coumarins (CHEBI:23403) |
| ferulsinaic acid (CHEBI:180832) is a monocarboxylic acid (CHEBI:25384) |
| ferulsinaic acid (CHEBI:180832) is a olefinic compound (CHEBI:78840) |
| ferulsinaic acid (CHEBI:180832) is a sesquiterpene lactone (CHEBI:37667) |
| IUPAC Name |
|---|
| 3-[(1R,2R,3S,5S)-1,3-dimethyl-5-(2-methylprop-1-en-1-yl)-2-{[(2-oxo-2H-chromen-7-yl)oxy]methyl}cyclopentyl]propanoic acid |
| Synonyms | Source |
|---|---|
| 3-[(1R,2R,3S,5S)-1,3-dimethyl-5-(2-methylprop-1-en-1-yl)-2-{[(2-oxo-2H-1-benzopyran-7-yl)oxy]methyl}cyclopentyl]propanoic acid | IUPAC |
| (−)-ferulsinaic acid | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00034514 | KNApSAcK |
| HMDB0252236 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:934822-64-7 | KNApSAcK |
| Citations |
|---|