EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7N5 |
| Net Charge | 0 |
| Average Mass | 149.157 |
| Monoisotopic Mass | 149.07015 |
| SMILES | Cn1cnc2ncnc-2c1N |
| InChI | InChI=1S/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3H,7H2,1H3 |
| InChIKey | HPZMWTNATZPBIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methyladenine (CHEBI:18083) has role metabolite (CHEBI:25212) |
| 1-methyladenine (CHEBI:18083) is a methyladenine (CHEBI:25272) |
| IUPAC Name |
|---|
| 1-methyl-1H-purin-6-amine |
| Synonyms | Source |
|---|---|
| 1-Methyladenine | KEGG COMPOUND |
| N1-methyladenine | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-methyladenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1-METHYLADENINE | MetaCyc |
| C02216 | KEGG COMPOUND |
| C02216 | KEGG COMPOUND |
| HMDB0011599 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:137917 | Reaxys |
| CAS:5142-22-3 | ChemIDplus |
| CAS:5142-22-3 | KEGG COMPOUND |
| Citations |
|---|