EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H60O17 |
| Net Charge | 0 |
| Average Mass | 824.914 |
| Monoisotopic Mass | 824.38305 |
| SMILES | Cc1c2c(cc(O)c1OC1OC(COC3OC(CO)C(O)C(O)C3O)C(O)C(O)C1O)C1(C)C(=O)CC3(C)C(C(C)(O)C(O)/C=C/C(C)(C)O)C(O)CC3(C)C1C=C2 |
| InChI | InChI=1S/C41H60O17/c1-17-18-8-9-24-38(4)13-21(44)34(41(7,54)25(45)10-11-37(2,3)53)39(38,5)14-26(46)40(24,6)19(18)12-20(43)33(17)58-36-32(52)30(50)28(48)23(57-36)16-55-35-31(51)29(49)27(47)22(15-42)56-35/h8-12,21-25,27-32,34-36,42-45,47-54H,13-16H2,1-7H3/b11-10+ |
| InChIKey | ASSSZPRIMUKILU-ZHACJKMWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2150) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,7-Didehydrofevicordin F 3-[glucosyl-(1->6)-glucoside] (CHEBI:180818) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| 2,16-dihydroxy-4,9,13,14-tetramethyl-17-[(E)-2,3,6-trihydroxy-6-methylhept-4-en-2-yl]-3-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-12,15,16,17-tetrahydro-8H-cyclopenta[a]phenanthren-11-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036337 | HMDB |