EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H62O4 |
| Net Charge | 0 |
| Average Mass | 510.844 |
| Monoisotopic Mass | 510.46481 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(CCC)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C32H62O4/c1-3-5-6-7-8-9-10-11-12-16-19-22-25-29-32(35)36-30(26-4-2)27-23-20-17-14-13-15-18-21-24-28-31(33)34/h30H,3-29H2,1-2H3,(H,33,34) |
| InChIKey | IHNHFVFOGDZMEW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FAHFA(16:0/13-O-16:0) (CHEBI:180811) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 13-hexadecanoyloxyhexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849765 | ChemSpider |
| HMDB0112127 | HMDB |
| LMFA07011073 | LIPID MAPS |