EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO6 |
| Net Charge | 0 |
| Average Mass | 239.183 |
| Monoisotopic Mass | 239.04299 |
| SMILES | O=C(O)CNC(=O)c1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C10H9NO6/c12-6-2-8-7(16-4-17-8)1-5(6)10(15)11-3-9(13)14/h1-2,12H,3-4H2,(H,11,15)(H,13,14) |
| InChIKey | BSGZBTVJZSNKKJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[hydroxy(6-hydroxy-2H-1,3-benzodioxol-5-yl)methylidene]amino}acetic acid (CHEBI:180790) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[(6-hydroxy-1,3-benzodioxole-5-carbonyl)amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0129401 | HMDB |
| 74852584 | ChemSpider |