EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30O9 |
| Net Charge | 0 |
| Average Mass | 510.539 |
| Monoisotopic Mass | 510.18898 |
| SMILES | C=C1C(=O)OC2CC1(C)C1C(=O)C3(O)OC14C(O)(CCC1C3CC=C3CC=CC(=O)C31C)C(=O)OC24C |
| InChI | InChI=1S/C28H30O9/c1-13-21(31)35-18-12-23(13,2)19-20(30)27(34)16-9-8-14-6-5-7-17(29)24(14,3)15(16)10-11-26(33)22(32)36-25(18,4)28(19,26)37-27/h5,7-8,15-16,18-19,33-34H,1,6,9-12H2,2-4H3 |
| InChIKey | OZDVKLAQLVYYJW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Physalin C (CHEBI:180767) is a physalin (CHEBI:76361) |
| IUPAC Name |
|---|
| 5,18-dihydroxy-1,14,21-trimethyl-25-methylidene-4,20,23-trioxaheptacyclo[20.3.1.12,5.03,18.03,21.06,15.09,14]heptacosa-8,11-diene-13,19,24,27-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 19718571 | ChemSpider |
| HMDB0034094 | HMDB |