EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O18 |
| Net Charge | 0 |
| Average Mass | 626.476 |
| Monoisotopic Mass | 626.11191 |
| SMILES | O=c1oc2c(O)c(OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)cc3c(=O)oc4c(O)c(O)cc1c4c23 |
| InChI | InChI=1S/C26H26O18/c27-3-9-14(30)17(33)19(35)25(41-9)39-4-10-15(31)18(34)20(36)26(42-10)40-8-2-6-12-11-5(23(37)44-22(12)16(8)32)1-7(28)13(29)21(11)43-24(6)38/h1-2,9-10,14-15,17-20,25-36H,3-4H2 |
| InChIKey | FHIYBTOOLROABN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Amritoside (CHEBI:180762) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6,7,14-trihydroxy-13-[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034258 | HMDB |