EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O3 |
| Net Charge | 0 |
| Average Mass | 222.284 |
| Monoisotopic Mass | 222.12559 |
| SMILES | CC(CO)Cc1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C13H18O3/c1-9(8-14)7-11-3-5-12(6-4-11)10(2)13(15)16/h3-6,9-10,14H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | HFAIHLSDLUYLQA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | MetaboLights (MTBLS2150) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS2150) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS2150) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxyibuprofen (CHEBI:180749) is a benzenes (CHEBI:22712) |
| 3-Hydroxyibuprofen (CHEBI:180749) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-[4-(3-hydroxy-2-methylpropyl)phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060921 | HMDB |
| 32699261 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53949-54-5 | ChemIDplus |