EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H14O15 |
| Net Charge | 0 |
| Average Mass | 506.328 |
| Monoisotopic Mass | 506.03327 |
| SMILES | O=C(O)c1cc(O)c(O)c(O)c1Oc1cc(C(=O)O)c(-c2c(C(=O)O)cc(O)c(O)c2O)c(O)c1O |
| InChI | InChI=1S/C21H14O15/c22-7-1-4(19(30)31)10(15(27)12(7)24)11-5(20(32)33)3-9(14(26)16(11)28)36-18-6(21(34)35)2-8(23)13(25)17(18)29/h1-3,22-29H,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | RUOFGJLCWJUJRS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(6-carboxy-2,3,4-trihydroxyphenoxy)-4',5,5',6,6'-pentahydroxy-[1,1'-biphenyl]-2,2'-dicarboxylic acid (CHEBI:180730) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 2-[6-carboxy-4-(6-carboxy-2,3,4-trihydroxyphenoxy)-2,3-dihydroxyphenyl]-3,4,5-trihydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 26538333 | ChemSpider |
| HMDB0136072 | HMDB |