EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O2S |
| Net Charge | -1 |
| Average Mass | 105.138 |
| Monoisotopic Mass | 105.00157 |
| SMILES | CSCC(=O)[O-] |
| InChI | InChI=1S/C3H6O2S/c1-6-2-3(4)5/h2H2,1H3,(H,4,5)/p-1 |
| InChIKey | HGTBAIVLETUVCG-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (methylthio)acetate (CHEBI:18071) has functional parent thioglycolate(1−) (CHEBI:30066) |
| (methylthio)acetate (CHEBI:18071) is a monocarboxylic acid anion (CHEBI:35757) |
| (methylthio)acetate (CHEBI:18071) is conjugate base of (methylthio)acetic acid (CHEBI:47870) |
| Incoming Relation(s) |
| (methylthio)acetic acid (CHEBI:47870) is conjugate acid of (methylthio)acetate (CHEBI:18071) |
| IUPAC Name |
|---|
| (methylsulfanyl)acetate |
| Synonyms | Source |
|---|---|
| S-methylthioglycolate | ChEBI |
| S-methylthioglycollic acid anion | ChEBI |
| [METHYLTHIO]ACETATE | PDBeChem |
| (methylthio)acetate(1−) | ChEBI |
| (methylthio)acetate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| (methylsulfanyl)acetate | UniProt |