EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O5S |
| Net Charge | 0 |
| Average Mass | 362.447 |
| Monoisotopic Mass | 362.11879 |
| SMILES | O=C(CCc1ccccc1)CCC(Cc1ccccc1)OS(=O)(=O)O |
| InChI | InChI=1S/C19H22O5S/c20-18(12-11-16-7-3-1-4-8-16)13-14-19(24-25(21,22)23)15-17-9-5-2-6-10-17/h1-10,19H,11-15H2,(H,21,22,23) |
| InChIKey | ZGQHJSXUOAALPI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(5-oxo-1,7-diphenylheptan-2-yl)oxy]sulfonic acid (CHEBI:180700) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (5-oxo-1,7-diphenylheptan-2-yl) hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| 74853650 | ChemSpider |
| HMDB0134656 | HMDB |