EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14ClMnN2O2 |
| Net Charge | 0 |
| Average Mass | 356.691 |
| Monoisotopic Mass | 356.01243 |
| SMILES | [Cl][Mn]123[O]c4ccccc4C=[N]1CC[N]2=Cc1ccccc1[O]3 |
| InChI | InChI=1S/C16H16N2O2.ClH.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;1H;/q;;+3/p-3/b17-11+,18-12+;; |
| InChIKey | HBQGFROGWOHBAG-SNTCFBDDSA-K |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EUK-8 (CHEBI:180693) has role anti-inflammatory agent (CHEBI:67079) |
| EUK-8 (CHEBI:180693) has role cardioprotective agent (CHEBI:77307) |
| EUK-8 (CHEBI:180693) has role geroprotector (CHEBI:176497) |
| EUK-8 (CHEBI:180693) has role radical scavenger (CHEBI:48578) |
| EUK-8 (CHEBI:180693) is a manganese coordination entity (CHEBI:35117) |
| IUPAC Name |
|---|
| chloro[2,2'-{ethane-1,2-diylbis[(azanylylidene-kappaN)methanylylidene]}diphenolato-κO(2−)]manganese |
| Synonyms | Source |
|---|---|
| manganese(3+) chloride 2,2'-{ethane-1,2-diylbis[azanylylidene(E)methanylylidene]}diphenolate (1:1:1) | IUPAC |
| EUK8 | ChemIDplus |
| EUK 8 | ChemIDplus |
| manganese(salen) chloride | ChEBI |
| eukarion-8 | ChEBI |
| eukarion 8 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 149712 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53177-12-1 | ChemIDplus |
| Citations |
|---|