EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14ClMnN2O2 |
| Net Charge | 0 |
| Average Mass | 356.691 |
| Monoisotopic Mass | 356.01243 |
| SMILES | [Cl][Mn]123[O]c4ccccc4C=[N]1CC[N]2=Cc1ccccc1[O]3 |
| InChI | InChI=1S/C16H16N2O2.ClH.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;1H;/q;;+3/p-3/b17-11+,18-12+;; |
| InChIKey | HBQGFROGWOHBAG-SNTCFBDDSA-K |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EUK-8 (CHEBI:180693) has role anti-inflammatory agent (CHEBI:67079) |
| EUK-8 (CHEBI:180693) has role cardioprotective agent (CHEBI:77307) |
| EUK-8 (CHEBI:180693) has role geroprotector (CHEBI:176497) |
| EUK-8 (CHEBI:180693) has role radical scavenger (CHEBI:48578) |
| EUK-8 (CHEBI:180693) is a manganese coordination entity (CHEBI:35117) |
| IUPAC Name |
|---|
| chloro[2,2'-{ethane-1,2-diylbis[(azanylylidene-kappaN)methanylylidene]}diphenolato-κO(2−)]manganese |
| Synonyms | Source |
|---|---|
| EUK 8 | ChemIDplus |
| EUK8 | ChemIDplus |
| eukarion 8 | ChEBI |
| eukarion-8 | ChEBI |
| manganese(3+) chloride 2,2'-{ethane-1,2-diylbis[azanylylidene(E)methanylylidene]}diphenolate (1:1:1) | IUPAC |
| manganese(salen) chloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 149712 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53177-12-1 | ChemIDplus |
| Citations |
|---|