EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22NO3 |
| Net Charge | 0 |
| Average Mass | 240.323 |
| Monoisotopic Mass | 240.15997 |
| SMILES | C=C(C)C(=O)OC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C13H22NO3/c1-9(2)11(15)17-10-7-12(3,4)14(16)13(5,6)8-10/h10H,1,7-8H2,2-6H3 |
| InChIKey | BTWSPOZXDCFMLX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | polymerisation monomer Any compound used as a monomer for a polymerisation process. The term is generally used in relation to industrial polymerisation processes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methacryloyloxy-TEMPO (CHEBI:180677) has functional parent TEMPO (CHEBI:32849) |
| 4-methacryloyloxy-TEMPO (CHEBI:180677) has role polymerisation monomer (CHEBI:74236) |
| 4-methacryloyloxy-TEMPO (CHEBI:180677) is a aminoxyls (CHEBI:39477) |
| 4-methacryloyloxy-TEMPO (CHEBI:180677) is a enoate ester (CHEBI:51702) |
| 4-methacryloyloxy-TEMPO (CHEBI:180677) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| {2,2,6,6-tetramethyl-4-[(2-methylprop-2-enoyl)oxy]piperidin-1-yl}oxidanyl |
| Synonyms | Source |
|---|---|
| 2,2,6,6-tetramethyl-4-[(2-methyl-1-oxo-2-propenyl)oxy]-1-piperidinyloxy | ChEBI |
| 4-methacryloyloxy-2,2,6,6-tetramethylpiperidine 1-oxyl | ChEBI |
| 4-methacryloyloxy-2,2,6,6-tetramethylpiperidine-1-oxyl | SUBMITTER |
| 4-methacryloyloxy-2,2,6,6-tetramethylpiperidinyloxyl | ChEBI |
| 4-methacryloyloxy-TEMPO free radical | ChEBI |
| PTMA monomer | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1377946 | Reaxys |
| CAS:15051-46-4 | SUBMITTER |
| Citations |
|---|