EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N2O3 |
| Net Charge | 0 |
| Average Mass | 251.306 |
| Monoisotopic Mass | 251.13957 |
| SMILES | CC1(C)CC(N2C(=O)C=CC2=O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C13H19N2O3/c1-12(2)7-9(8-13(3,4)15(12)18)14-10(16)5-6-11(14)17/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | CMNDHIFMYRPBGH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Application: | spin label A role played by a stable paramagnetic group that is attached to a part of a molecular entity whose microscopic environment is of interest and may be revealed by the electron spin resonance (ESR) spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-maleimido-TEMPO (CHEBI:180675) has functional parent TEMPO (CHEBI:32849) |
| 4-maleimido-TEMPO (CHEBI:180675) has role radical scavenger (CHEBI:48578) |
| 4-maleimido-TEMPO (CHEBI:180675) has role spin label (CHEBI:35210) |
| 4-maleimido-TEMPO (CHEBI:180675) is a aminoxyls (CHEBI:39477) |
| 4-maleimido-TEMPO (CHEBI:180675) is a dicarboximide (CHEBI:35356) |
| 4-maleimido-TEMPO (CHEBI:180675) is a maleimides (CHEBI:55417) |
| 4-maleimido-TEMPO (CHEBI:180675) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| [4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-2,2,6,6-tetramethylpiperidin-1-yl]oxidanyl |
| Synonyms | Source |
|---|---|
| 2,2,6,6-tetramethyl-4-maleimidopiperidine-1-oxyl | ChemIDplus |
| 2,2,6,6-tetramethylpiperdin-N-1-oxymaleimide | ChemIDplus |
| 4-N-maleimido-2,2,6,6-tetramethylpiperidine-1-oxyl | ChemIDplus |
| 4-N-maleimido-2,2,6,6-tetramethylpiperidine nitroxide | ChemIDplus |
| 4-maleimido-2,2,6,6-tetramethyl-1-piperidinyloxy | ChEBI |
| 4-maleimido-2,2,6,6-tetramethylpiperidine-1-oxyl | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2006453 | ChemSpider |
| HMDB0258806 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:15178-63-9 | ChemIDplus |
| Citations |
|---|