EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N2O2 |
| Net Charge | 0 |
| Average Mass | 213.301 |
| Monoisotopic Mass | 213.16030 |
| SMILES | CC(=O)NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C11H21N2O2/c1-8(14)12-9-6-10(2,3)13(15)11(4,5)7-9/h9H,6-7H2,1-5H3,(H,12,14) |
| InChIKey | UXBLSWOMIHTQPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Application: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-acetamido-TEMPO (CHEBI:180673) has functional parent 4-amino-TEMPO (CHEBI:180672) |
| 4-acetamido-TEMPO (CHEBI:180673) has role radiation protective agent (CHEBI:66987) |
| 4-acetamido-TEMPO (CHEBI:180673) has role radical scavenger (CHEBI:48578) |
| 4-acetamido-TEMPO (CHEBI:180673) is a aminoxyls (CHEBI:39477) |
| 4-acetamido-TEMPO (CHEBI:180673) is a piperidinecarboxamide (CHEBI:48592) |
| 4-acetamido-TEMPO (CHEBI:180673) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (4-acetamido-2,2,6,6-tetramethylpiperidin-1-yl)oxidanyl |
| Synonyms | Source |
|---|---|
| 2,2,6,6-tetramethyl-4-acetamidopiperidin-1-oxyl | ChEBI |
| 2,2,6,6-tetramethyl-4-acetamidopiperidine-1-oxyl | SUBMITTER |
| 2,2,6,6-tetramethyl-4-acetylaminopiperidin-1-oxyl | ChEBI |
| 4-acetamide-TEMPO | ChEBI |
| 4-acetamido-1-oxyl-2,2,6,6-tetramethylpiperidine | ChEBI |
| 4-acetamido-2,2,6,6-tetramethyl-1-piperidinyloxy | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 452722 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322085 | Reaxys |
| CAS:14691-89-5 | ChemIDplus |
| CAS:14691-89-5 | NIST Chemistry WebBook |
| Citations |
|---|