EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18NO3 |
| Net Charge | 0 |
| Average Mass | 200.258 |
| Monoisotopic Mass | 200.12867 |
| SMILES | CC1(C)CC(C(=O)O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C10H18NO3/c1-9(2)5-7(8(12)13)6-10(3,4)11(9)14/h7H,5-6H2,1-4H3,(H,12,13) |
| InChIKey | CYQGCJQJIOARKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | spin label A role played by a stable paramagnetic group that is attached to a part of a molecular entity whose microscopic environment is of interest and may be revealed by the electron spin resonance (ESR) spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxy-TEMPO (CHEBI:180671) has functional parent TEMPO (CHEBI:32849) |
| 4-carboxy-TEMPO (CHEBI:180671) has role MRI contrast agent (CHEBI:37335) |
| 4-carboxy-TEMPO (CHEBI:180671) has role radical scavenger (CHEBI:48578) |
| 4-carboxy-TEMPO (CHEBI:180671) has role spin label (CHEBI:35210) |
| 4-carboxy-TEMPO (CHEBI:180671) is a aminoxyls (CHEBI:39477) |
| 4-carboxy-TEMPO (CHEBI:180671) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| IUPAC Name |
|---|
| (4-carboxy-2,2,6,6-tetramethylpiperidin-1-yl)oxidanyl |
| Synonyms | Source |
|---|---|
| 2,2,6,6-tetramethyl-4-carboxypiperidine-1-oxyl | SUBMITTER |
| 4-carboxy-2,2,6,6-tetramethyl-1-piperidinyloxy | ChEBI |
| 4-carboxy-2,2,6,6-tetramethylpiperidine 1-oxyl | ChEBI |
| 4-carboxy-2,2,6,6-tetramethylpiperidine-1-oxyl | ChEBI |
| 4-carboxy-2,2,6,6-tetramethylpiperidine-N-oxyl | ChEBI |
| 4-carboxy-2,2,6,6-tetramethylpiperidinyloxy | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2338518 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12666306 | Reaxys |
| CAS:37149-18-1 | ChemIDplus |
| CAS:37149-18-1 | NIST Chemistry WebBook |
| Citations |
|---|