EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20NO2 |
| Net Charge | 0 |
| Average Mass | 186.275 |
| Monoisotopic Mass | 186.14940 |
| SMILES | COC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C10H20NO2/c1-9(2)6-8(13-5)7-10(3,4)11(9)12/h8H,6-7H2,1-5H3 |
| InChIKey | SFXHWRCRQNGVLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxy-TEMPO (CHEBI:180670) has functional parent TEMPO (CHEBI:32849) |
| 4-methoxy-TEMPO (CHEBI:180670) has role apoptosis inducer (CHEBI:68495) |
| 4-methoxy-TEMPO (CHEBI:180670) has role autophagy inducer (CHEBI:138880) |
| 4-methoxy-TEMPO (CHEBI:180670) has role radical scavenger (CHEBI:48578) |
| 4-methoxy-TEMPO (CHEBI:180670) is a aminoxyls (CHEBI:39477) |
| 4-methoxy-TEMPO (CHEBI:180670) is a ether (CHEBI:25698) |
| 4-methoxy-TEMPO (CHEBI:180670) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| (4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxidanyl |
| Synonyms | Source |
|---|---|
| 2,2,6,6-tetramethyl-4-methoxy-1-piperidinyloxy | ChEBI |
| 2,2,6,6-tetramethyl-4-methoxypiperidine 1-oxide | ChEBI |
| 2,2,6,6-Tetramethyl-4-methoxypiperidine-1-oxyl | SUBMITTER |
| 2,2,6,6-tetramethylpiperidine-4-methoxy-1-oxyl | ChEBI |
| 4-methoxy-2,2,6,6-tetramethyl-1-piperidinyloxy | ChEBI |
| 4-methoxy-2,2,6,6-tetramethylpiperidin-1-oxy | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8488900 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4740399 | Reaxys |
| CAS:95407-69-5 | ChemIDplus |
| Citations |
|---|