EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16NO2 |
| Net Charge | 0 |
| Average Mass | 170.232 |
| Monoisotopic Mass | 170.11810 |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3 |
| InChIKey | WSGDRFHJFJRSFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxo-TEMPO (CHEBI:180665) has functional parent TEMPO (CHEBI:32849) |
| 4-oxo-TEMPO (CHEBI:180665) has role radical scavenger (CHEBI:48578) |
| 4-oxo-TEMPO (CHEBI:180665) is a aminoxyls (CHEBI:39477) |
| 4-oxo-TEMPO (CHEBI:180665) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| (2,2,6,6-tetramethyl-4-oxopiperidin-1-yl)oxidanyl |
| Synonyms | Source |
|---|---|
| 2,2,6,6-tetramethyl-4-oxo-1-piperidinyloxy | ChEBI |
| 2,2,6,6-tetramethyl-4-oxo-piperidin-1-oxyl | ChemIDplus |
| 2,2,6,6-Tetramethyl-4-oxopiperidine-1-oxyl | SUBMITTER |
| 2,2,6,6-tetramethyl-4-piperidone 1-nitroxide | ChEBI |
| 2,2,6,6-tetramethyl-4-piperidone N-oxide | ChEBI |
| 2,2,6,6-tetramethyl-4-piperidone-N-oxy | ChEBI |
| Citations |
|---|