EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10N2O2 |
| Net Charge | 0 |
| Average Mass | 130.147 |
| Monoisotopic Mass | 130.07423 |
| SMILES | [H][C@@]1(C(=O)O)CCCNN1 |
| InChI | InChI=1S/C5H10N2O2/c8-5(9)4-2-1-3-6-7-4/h4,6-7H,1-3H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | BZIBRGSBQKLEDC-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-1,2-diazinane-3-carboxylic acid (CHEBI:180655) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| (3S)-piperazate | SUBMITTER |
| Citations |
|---|