EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O2 |
| Net Charge | 0 |
| Average Mass | 275.352 |
| Monoisotopic Mass | 275.16338 |
| SMILES | [H]/C(=N\O)C(=O)N[C@@H](C)CN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C15H21N3O2/c1-12(17-15(19)9-16-20)10-18-8-4-7-13-5-2-3-6-14(13)11-18/h2-3,5-6,9,12,20H,4,7-8,10-11H2,1H3,(H,17,19)/b16-9+/t12-/m0/s1 |
| InChIKey | VGSLVDUZHCKPJC-RGZVIEDOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antidote to organophosphate poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of organophosphates or acetylcholinesterase inhibitors (nerve agents). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LLNL-02 (CHEBI:180652) has role antidote to organophosphate poisoning (CHEBI:90753) |
| LLNL-02 (CHEBI:180652) is a aldoxime (CHEBI:22307) |
| LLNL-02 (CHEBI:180652) is a benzazepine (CHEBI:35676) |
| LLNL-02 (CHEBI:180652) is a secondary carboxamide (CHEBI:140325) |
| LLNL-02 (CHEBI:180652) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (2E)-2-(hydroxyimino)-N-[(2S)-1-(1,3,4,5-tetrahydro-2H-2-benzazepin-2-yl)propan-2-yl]acetamide |
| Synonyms | Source |
|---|---|
| LLNL02 | ChEBI |
| LLNL 02 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US20190152920 | Patent |
| Citations |
|---|