EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31N3O6S |
| Net Charge | 0 |
| Average Mass | 477.583 |
| Monoisotopic Mass | 477.19336 |
| SMILES | C#Cc1cccc(COC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C/S(C)(=O)=O)CCC(N)=O)c1 |
| InChI | InChI=1S/C23H31N3O6S/c1-5-17-7-6-8-18(14-17)15-32-23(29)26-20(13-16(2)3)22(28)25-19(9-10-21(24)27)11-12-33(4,30)31/h1,6-8,11-12,14,16,19-20H,9-10,13,15H2,2-4H3,(H2,24,27)(H,25,28)(H,26,29)/b12-11+/t19-,20-/m0/s1 |
| InChIKey | AYTVESLXVZAGIT-ARZGSZHJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2CN115 (CHEBI:180646) has role anticoronaviral agent (CHEBI:149553) |
| 2CN115 (CHEBI:180646) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| 2CN115 (CHEBI:180646) is a carboxylic ester (CHEBI:33308) |
| 2CN115 (CHEBI:180646) is a olefinic compound (CHEBI:78840) |
| 2CN115 (CHEBI:180646) is a oligopeptide (CHEBI:25676) |
| 2CN115 (CHEBI:180646) is a primary carboxamide (CHEBI:140324) |
| 2CN115 (CHEBI:180646) is a secondary carboxamide (CHEBI:140325) |
| 2CN115 (CHEBI:180646) is a sulfone (CHEBI:35850) |
| 2CN115 (CHEBI:180646) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| N-[(1E,3S)-6-amino-1-(methylsulfonyl)-6-oxohex-1-en-3-yl]-N2-{[(3-ethynylbenzyl)oxy]carbonyl}-L-leucinamide |
| Synonyms | Source |
|---|---|
| (3-ethynylphenyl)methyl N-[(1S)-1-{[(1E,3S)-5-carbamoyl-1-methanesulfonylpent-1-en-3-yl]carbamoyl}-3-methylbutyl]carbamate | IUPAC |
| AL-Cbz-Leu-Gln-VS | ChEBI |
| N-[(1E,3S)-6-amino-1-(methanesulfonyl)-6-oxohex-1-en-3-yl]-N2-{[(3-ethynylphenyl)methoxy]carbonyl}-L-leucinamide | IUPAC |
| Citations |
|---|