EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N3O6S |
| Net Charge | 0 |
| Average Mass | 453.561 |
| Monoisotopic Mass | 453.19336 |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](/C=C/S(C)(=O)=O)CCC(N)=O |
| InChI | InChI=1S/C21H31N3O6S/c1-15(2)13-18(24-21(27)30-14-16-7-5-4-6-8-16)20(26)23-17(9-10-19(22)25)11-12-31(3,28)29/h4-8,11-12,15,17-18H,9-10,13-14H2,1-3H3,(H2,22,25)(H,23,26)(H,24,27)/b12-11+/t17-,18-/m0/s1 |
| InChIKey | XNUMKBHURGKYTO-JWSDNSILSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2CN113 (CHEBI:180645) has role anticoronaviral agent (CHEBI:149553) |
| 2CN113 (CHEBI:180645) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| 2CN113 (CHEBI:180645) is a benzyl ester (CHEBI:90628) |
| 2CN113 (CHEBI:180645) is a olefinic compound (CHEBI:78840) |
| 2CN113 (CHEBI:180645) is a oligopeptide (CHEBI:25676) |
| 2CN113 (CHEBI:180645) is a primary carboxamide (CHEBI:140324) |
| 2CN113 (CHEBI:180645) is a secondary carboxamide (CHEBI:140325) |
| 2CN113 (CHEBI:180645) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-[(1E,3S)-6-amino-1-(methylsulfonyl)-6-oxohex-1-en-3-yl]-N2-[(benzyloxy)carbonyl]-L-leucinamide |
| Synonyms | Source |
|---|---|
| benzyl N-[(1S)-1-{[(1E,3S)-5-carbamoyl-1-methanesulfonylpent-1-en-3-yl]carbamoyl}-3-methylbutyl]carbamate | IUPAC |
| Cbz-Leu-Gln-VS | ChEBI |
| N-[(1E,3S)-6-amino-1-(methanesulfonyl)-6-oxohex-1-en-3-yl]-N2-[(benzyloxy)carbonyl]-L-leucinamide | IUPAC |
| Citations |
|---|