EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | CC(CO)C(=O)O |
| InChI | InChI=1S/C4H8O3/c1-3(2-5)4(6)7/h3,5H,2H2,1H3,(H,6,7) |
| InChIKey | DBXBTMSZEOQQDU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyisobutyric acid (CHEBI:18064) has functional parent propionic acid (CHEBI:30768) |
| 3-hydroxyisobutyric acid (CHEBI:18064) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxyisobutyric acid (CHEBI:18064) is conjugate acid of 3-hydroxyisobutyrate (CHEBI:11805) |
| Incoming Relation(s) |
| (S)-3-hydroxyisobutyric acid (CHEBI:37373) is a 3-hydroxyisobutyric acid (CHEBI:18064) |
| 3-hydroxyisobutyrate (CHEBI:11805) is conjugate base of 3-hydroxyisobutyric acid (CHEBI:18064) |
| IUPAC Name |
|---|
| 3-hydroxy-2-methylpropanoic acid |
| Synonyms | Source |
|---|---|
| 2-methyl-3-hydroxypropanoic acid | ChEBI |
| 3-Hydroxyisobutyric acid | KEGG COMPOUND |
| HIBA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01188 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1745484 | Beilstein |
| CAS:2068-83-9 | KEGG COMPOUND |