EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N5O6 |
| Net Charge | 0 |
| Average Mass | 591.709 |
| Monoisotopic Mass | 591.30568 |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2Oc3ccc(OC)c(c3)/C=C/NC(=O)C(Cc3ccccc3)NC(=O)C21)C(C)C |
| InChI | InChI=1S/C32H41N5O6/c1-19(2)27(36-29(38)20(3)33-4)32(41)37-16-14-26-28(37)31(40)35-24(17-21-9-7-6-8-10-21)30(39)34-15-13-22-18-23(43-26)11-12-25(22)42-5/h6-13,15,18-20,24,26-28,33H,14,16-17H2,1-5H3,(H,34,39)(H,35,40)(H,36,38)/b15-13+ |
| InChIKey | ZAVCUVYFGQXSRX-FYWRMAATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nummularine B (CHEBI:180633) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-[1-[(13E)-10-benzyl-16-methoxy-8,11-dioxo-2-oxa-6,9,12-triazatricyclo[13.3.1.03,7]nonadeca-1(19),13,15,17-tetraen-6-yl]-3-methyl-1-oxobutan-2-yl]-2-(methylamino)propanamide |
| Manual Xrefs | Databases |
|---|---|
| 35032852 | ChemSpider |
| HMDB0029334 | HMDB |