EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9NOS |
| Net Charge | 0 |
| Average Mass | 227.288 |
| Monoisotopic Mass | 227.04048 |
| SMILES | Oc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C13H9NOS/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H |
| InChIKey | MVVGSPCXHRFDDR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(1,3-benzothiazol-2-yl)phenol (CHEBI:180629) has role geroprotector (CHEBI:176497) |
| 2-(1,3-benzothiazol-2-yl)phenol (CHEBI:180629) is a benzothiazoles (CHEBI:37947) |
| 2-(1,3-benzothiazol-2-yl)phenol (CHEBI:180629) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2-(1,3-benzothiazol-2-yl)phenol |
| Synonyms | Source |
|---|---|
| 2-(2-benzothiazolyl)phenol | ChemIDplus |
| 2-(2-hydroxyphenyl)-1,3-benzothiazole | ChEBI |
| 2-(2'-hydroxyphenyl)-2-benzothiazole | ChEBI |
| 2-(2-hydroxyphenyl)benzothiazole | ChemIDplus |
| 2-(2'-hydroxyphenyl)benzothiazole | ChemIDplus |
| 2-(benzo[d]thiazol-2-yl)phenol | ChEBI |
| Citations |
|---|