EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2HO4.CH6N3 |
| Net Charge | 0 |
| Average Mass | 149.106 |
| Monoisotopic Mass | 149.04366 |
| SMILES | NC(N)=[NH2+].O=C([O-])C(=O)O |
| InChI | InChI=1S/C2H2O4.CH5N3/c3-1(4)2(5)6;2-1(3)4/h(H,3,4)(H,5,6);(H5,2,3,4) |
| InChIKey | PBPSWRVGRHWHEW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxalic acid-guanidine (CHEBI:180627) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| diaminomethylideneazanium;2-hydroxy-2-oxoacetate |
| Manual Xrefs | Databases |
|---|---|
| 13406201 | ChemSpider |