EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CCCCOC(=O)c1ccc(C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-7-9-14(10-8-13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | LQLQDKBJAIILIQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dibutyl terephthalate (CHEBI:180625) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| dibutyl benzene-1,4-dicarboxylate |