EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | CCC(N)CC(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-2-4(6)3-5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | QFRURJKLPJVRQY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Aminopentanoic acid (CHEBI:180619) has functional parent β-amino acid (CHEBI:33706) |
| 3-Aminopentanoic acid (CHEBI:180619) is a organonitrogen compound (CHEBI:35352) |
| 3-Aminopentanoic acid (CHEBI:180619) is a organooxygen compound (CHEBI:36963) |
| Incoming Relation(s) |
| 3-ammoniopentanoate (CHEBI:760588) is conjugate base of 3-Aminopentanoic acid (CHEBI:180619) |
| IUPAC Name |
|---|
| 3-aminopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 11271826 | ChemSpider |