EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N4O7 |
| Net Charge | 0 |
| Average Mass | 396.400 |
| Monoisotopic Mass | 396.16450 |
| SMILES | CC(O)C(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C17H24N4O7/c1-9(22)15(18)17(28)21-12(6-10-2-4-11(23)5-3-10)16(27)20-7-13(24)19-8-14(25)26/h2-5,9,12,15,22-23H,6-8,18H2,1H3,(H,19,24)(H,20,27)(H,21,28)(H,25,26) |
| InChIKey | HGZINTSBOUQIBU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Tyr-Gly-Gly (CHEBI:180613) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]acetyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 16711050 | ChemSpider |