EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N6O8 |
| Net Charge | 0 |
| Average Mass | 428.402 |
| Monoisotopic Mass | 428.16556 |
| SMILES | CC(O)C(NC(=O)C(N)CC(=O)O)C(=O)NC(Cc1cncn1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C16H24N6O8/c1-7(23)13(22-14(28)9(17)3-11(24)25)16(30)21-10(2-8-4-18-6-20-8)15(29)19-5-12(26)27/h4,6-7,9-10,13,23H,2-3,5,17H2,1H3,(H,18,20)(H,19,29)(H,21,30)(H,22,28)(H,24,25)(H,26,27) |
| InChIKey | GXAJEYWSNDOXFA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp Thr His Gly (CHEBI:180612) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 3-amino-4-[[1-[[1-(carboxymethylamino)-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16606587 | ChemSpider |