EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:180606 - Nitrofor
| Formula | C11H12F3N3O4 |
| Net Charge | 0 |
| Average Mass | 307.228 |
| Monoisotopic Mass | 307.07799 |
| SMILES | CCN(CC)c1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F3N3O4/c1-3-15(4-2)10-8(16(18)19)5-7(11(12,13)14)6-9(10)17(20)21/h5-6H,3-4H2,1-2H3 |
| InChIKey | NLLHXVBITYTYHA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nitrofor (CHEBI:180606) is a nitroaniline (CHEBI:25550) |
| IUPAC Name |
|---|
| N,N-diethyl-2,6-dinitro-4-(triluoromethyl)aniline |