EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N.I |
| Net Charge | 0 |
| Average Mass | 351.231 |
| Monoisotopic Mass | 351.04840 |
| SMILES | C[N+](C)(C)C1c2ccccc2-c2ccccc21.[I-] |
| InChI | InChI=1S/C16H18N.HI/c1-17(2,3)16-14-10-6-4-8-12(14)13-9-5-7-11-15(13)16;/h4-11,16H,1-3H3;1H/q+1;/p-1 |
| InChIKey | SRTHEZCSMSAQJC-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N,N-Trimethyl-9H-fluoren-9-aminium iodide (CHEBI:180604) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| 9H-luoren-9-yl(trimethyl)azanium;iodide |
| Manual Xrefs | Databases |
|---|---|
| 28566896 | ChemSpider |