EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32N6O12S2 |
| Net Charge | 0 |
| Average Mass | 612.640 |
| Monoisotopic Mass | 612.15196 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)NCC(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N6O12S2/c21-9(2-4-14(28)29)17(34)26-12(19(36)24-6-16(32)33)8-40-39-7-11(18(35)23-5-15(30)31)25-13(27)3-1-10(22)20(37)38/h9-12H,1-8,21-22H2,(H,23,35)(H,24,36)(H,25,27)(H,26,34)(H,28,29)(H,30,31)(H,32,33)(H,37,38)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | JRBLIKMXDVZVGD-BJDJZHNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-alpha-Glutamyl-L-cysteinylglycine Glutathione (CHEBI:180597) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(2R)-3-[[(2R)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]-3-(carboxymethylamino)-3-oxopropyl]disulanyl]-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 48063102 | ChemSpider |