EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | COCC(N)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | KNTFCRCCPLEUQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-Methyl-DL-serine (CHEBI:180594) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-methoxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 88436 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:19794-53-7 | ChemIDplus |