EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3 |
| Net Charge | 0 |
| Average Mass | 132.119 |
| Monoisotopic Mass | 132.05349 |
| SMILES | NC(=O)[C@H](CO)NC=O |
| InChI | InChI=1S/C4H8N2O3/c5-4(9)3(1-7)6-2-8/h2-3,7H,1H2,(H2,5,9)(H,6,8)/t3-/m0/s1 |
| InChIKey | HDVVKVPLJFERLU-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-Formyl-L-serinamide (CHEBI:180592) is a N-formyl amino acid (CHEBI:50759) |
| IUPAC Name |
|---|
| (2S)-2-ormamido-3-hydroxypropanamide |
| Manual Xrefs | Databases |
|---|---|
| 57528913 | ChemSpider |