EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO5 |
| Net Charge | 0 |
| Average Mass | 175.140 |
| Monoisotopic Mass | 175.04807 |
| SMILES | CON=C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C6H9NO5/c1-10-5(8)4(7-12-3)6(9)11-2/h1-3H3 |
| InChIKey | FOCKMBBVQYRNGP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Propanedioic acid, (methoxyimino)-, dimethyl ester (CHEBI:180591) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| dimethyl 2-methoxyiminopropanedioate |
| Manual Xrefs | Databases |
|---|---|
| 476892 | ChemSpider |