EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N5O6S |
| Net Charge | 0 |
| Average Mass | 465.532 |
| Monoisotopic Mass | 465.16820 |
| SMILES | CC(O)C(NC(=O)C(N)Cc1cnc2ccccc12)C(=O)NCC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C20H27N5O6S/c1-10(26)17(19(29)23-8-16(27)24-15(9-32)20(30)31)25-18(28)13(21)6-11-7-22-14-5-3-2-4-12(11)14/h2-5,7,10,13,15,17,22,26,32H,6,8-9,21H2,1H3,(H,23,29)(H,24,27)(H,25,28)(H,30,31) |
| InChIKey | WKBSMXJENZTPNS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Thr-Gly-Cys (CHEBI:180574) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]-3-sulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16718234 | ChemSpider |