EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H33N5O8S |
| Net Charge | 0 |
| Average Mass | 551.622 |
| Monoisotopic Mass | 551.20498 |
| SMILES | CSCCC(NC(=O)C(CC(=O)O)NC(=O)C(N)Cc1cnc2ccccc12)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C24H33N5O8S/c1-12(30)20(24(36)37)29-22(34)17(7-8-38-2)27-23(35)18(10-19(31)32)28-21(33)15(25)9-13-11-26-16-6-4-3-5-14(13)16/h3-6,11-12,15,17-18,20,26,30H,7-10,25H2,1-2H3,(H,27,35)(H,28,33)(H,29,34)(H,31,32)(H,36,37) |
| InChIKey | UDTIAIKCNKLGQN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Asp-Met-Thr (CHEBI:180572) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 3-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-[[1-[(1-carboxy-2-hydroxypropyl)amino]-4-methylsulanyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16713152 | ChemSpider |