EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO |
| Net Charge | 0 |
| Average Mass | 137.182 |
| Monoisotopic Mass | 137.08406 |
| SMILES | N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C8H11NO/c9-8(6-10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2/t8-/m0/s1 |
| InChIKey | IJXJGQCXFSSHNL-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | pancreas (BTO:0000988) | MetaboLights (MTBLS1925) | Strain: PANC-1 cell [BCGO:0000122] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-(-)-2-Phenylglycinol (CHEBI:180555) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| (2R)-2-amino-2-phenylethanol |
| Manual Xrefs | Databases |
|---|---|
| 2006200 | ChemSpider |