EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12ClN |
| Net Charge | 0 |
| Average Mass | 169.655 |
| Monoisotopic Mass | 169.06583 |
| SMILES | CC(N)Cc1ccccc1Cl |
| InChI | InChI=1S/C9H12ClN/c1-7(11)6-8-4-2-3-5-9(8)10/h2-5,7H,6,11H2,1H3 |
| InChIKey | IQHHOHJDIZRBGM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS3233) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Chloroamphetamine (CHEBI:180535) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 1-(2-chlorophenyl)propan-2-amine |
| Manual Xrefs | Databases |
|---|---|
| 134269 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:21193-23-7 | ChemIDplus |