EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31NO12 |
| Net Charge | 0 |
| Average Mass | 537.518 |
| Monoisotopic Mass | 537.18463 |
| SMILES | COc1cc(/C=C/C(=O)O[C@H]2[C@H](O[C@@H]3C[C@H](OC)[C@H](O)[C@@H](O)/C3=C\C#N)O[C@H](CO)[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C25H31NO12/c1-34-16-9-12(3-5-14(16)28)4-6-19(29)38-24-23(33)22(32)18(11-27)37-25(24)36-15-10-17(35-2)21(31)20(30)13(15)7-8-26/h3-7,9,15,17-18,20-25,27-28,30-33H,10-11H2,1-2H3/b6-4+,13-7-/t15-,17+,18-,20+,21+,22-,23+,24-,25-/m1/s1 |
| InChIKey | RSANRMXIULPPSK-YTUJPKJZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS3233) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Demethylsimmondsin 2'-ferulate (CHEBI:180515) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(2R,3R,4S,5S,6R)-2-[(1R,2E,3S,4R,5S)-2-(cyanomethylidene)-3,4-dihydroxy-5-methoxycyclohexyl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |