EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N6O6S |
| Net Charge | 0 |
| Average Mass | 496.590 |
| Monoisotopic Mass | 496.21040 |
| SMILES | CSC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OCCCCCn1cnc2c(=O)ncnc21)C(=O)O |
| InChI | InChI=1S/C21H32N6O6S/c1-13(2)9-14(18(28)25-15(10-34-3)20(30)31)26-21(32)33-8-6-4-5-7-27-12-24-16-17(27)22-11-23-19(16)29/h11-15H,4-10H2,1-3H3,(H,25,28)(H,26,32)(H,30,31)(H,22,23,29)/t14-,15-/m0/s1 |
| InChIKey | SKBHSRFBICJHSL-GJZGRUSLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2259) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Omega-(Hypoxanthin-9-yl)-pentoxycarbonyl-leucyl-methionine (CHEBI:180514) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-4-methyl-2-[5-(6-oxo-1H-purin-9-yl)pentoxycarbonylamino]pentanoyl]amino]-3-methylsulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 115764 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:126869-52-1 | ChemIDplus |