EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O6 |
| Net Charge | 0 |
| Average Mass | 310.346 |
| Monoisotopic Mass | 310.14164 |
| SMILES | [H][C@]12CC(=O)[C@H](CCC(=O)CCCCC(=O)O)[C@@]1([H])CCC(=O)O2 |
| InChI | InChI=1S/C16H22O6/c17-10(3-1-2-4-15(19)20)5-6-11-12-7-8-16(21)22-14(12)9-13(11)18/h11-12,14H,1-9H2,(H,19,20)/t11-,12-,14+/m1/s1 |
| InChIKey | KRZCZJUXOKTLEH-BZPMIXESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS3233) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclopenta[b]pyran-5-octanoic acid, octahydro-.epsilon.,2,6-trioxo-, (4aR,5R,7aS)- (CHEBI:180512) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 8-[(4aR,5R,7aS)-2,6-dioxo-3,4,4a,5,7,7a-hexahydrocyclopenta[b]pyran-5-yl]-6-oxooctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29341943 | ChemSpider |