EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28N2.2HCl |
| Net Charge | 0 |
| Average Mass | 465.468 |
| Monoisotopic Mass | 464.17860 |
| SMILES | Cl.Cl.c1ccc(C(NCCNC(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2.2ClH/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)29-21-22-30-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;;/h1-20,27-30H,21-22H2;2*1H |
| InChIKey | YRQCDCNQANSUPB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabotropic glutamate receptor agonist An agonist that selectively binds to and activates a metabotropic glutamate receptor. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AMN082 dihydrochloride (CHEBI:180500) has part N,N'-bis(diphenylmethyl)ethane-1,2-diamine(2+) (CHEBI:180501) |
| AMN082 dihydrochloride (CHEBI:180500) has role geroprotector (CHEBI:176497) |
| AMN082 dihydrochloride (CHEBI:180500) has role metabotropic glutamate receptor agonist (CHEBI:61966) |
| AMN082 dihydrochloride (CHEBI:180500) has role neuroprotective agent (CHEBI:63726) |
| AMN082 dihydrochloride (CHEBI:180500) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N'-bis(diphenylmethyl)ethane-1,2-diamine dihydrochloride |
| Synonyms | Source |
|---|---|
| AMN 082 | ChEBI |
| AMN082 | ChEBI |
| N,N'-bis(diphenylmethyl)-1,2-ethanediamine dihydrochloride | ChEBI |
| N,N'-bis(diphenylmethyl)ethane-1,2-bis(aminium) dichloride | IUPAC |
| N,N'-dibenzhydryl-1,2-ethanediamine dihydrochloride | ChEBI |
| N,N'-dibenzhydrylethylenediamine dihydrochloride | ChEBI |
| Citations |
|---|