EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22N4O |
| Net Charge | 0 |
| Average Mass | 370.456 |
| Monoisotopic Mass | 370.17936 |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2C1CCCC1 |
| InChI | InChI=1S/C23H22N4O/c24-22-21-20(14-27(17-6-4-5-7-17)23(21)26-15-25-22)16-10-12-19(13-11-16)28-18-8-2-1-3-9-18/h1-3,8-15,17H,4-7H2,(H2,24,25,26) |
| InChIKey | FMETVQKSDIOGPX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that specifically blocks the action of non-specific protein-tyrosine kinase (EC 2.7.10.2). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RK-24466 (CHEBI:180499) has role EC 2.7.10.2 (non-specific protein-tyrosine kinase) inhibitor (CHEBI:76617) |
| RK-24466 (CHEBI:180499) has role geroprotector (CHEBI:176497) |
| RK-24466 (CHEBI:180499) is a aromatic amine (CHEBI:33860) |
| RK-24466 (CHEBI:180499) is a aromatic ether (CHEBI:35618) |
| RK-24466 (CHEBI:180499) is a cyclopentanes (CHEBI:23493) |
| RK-24466 (CHEBI:180499) is a primary amino compound (CHEBI:50994) |
| RK-24466 (CHEBI:180499) is a pyrrolopyrimidine (CHEBI:38670) |
| IUPAC Name |
|---|
| 7-cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| 4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[3,2-d]pyrimidin-7-yl-cyclopentane | ChEBI |
| 7-cyclopentyl-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-ylamine | ChEBI |
| KIN001-051 | ChEBI |
| KIN 001-51 | ChEBI |
| RK 24466 | ChEBI |
| RK24466 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5036104 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:213743-31-8 | ChEBI |
| Citations |
|---|